C17H24Cl3N — CID 81391570
(1S)-1-cycloheptyl-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine (PubChem CID 81391570) has the molecular formula C17H24Cl3N and a molecular weight of 348.75 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81391570 |
| Molecular Formula | C17H24Cl3N |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[1-(2,3,4-trichlorophenyl)ethyl]ethanamine |
| SMILES | CC(N[C@@H](C)C1CCCCCC1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C17H24Cl3N/c1-11(13-7-5-3-4-6-8-13)21-12(2)14-9-10-15(18)17(20)16(14)19/h9-13,21H,3-8H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | GPOUYLMQBIBDQB-PXYINDEMSA-N |
| XLogP | 6.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|