C17H25Cl2N — CID 81392727
(1R)-1-cycloheptyl-N-[1-(2,5-dichlorophenyl)ethyl]ethanamine (PubChem CID 81392727) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is (1R)-1-cycloheptyl-N-[1-(2,5-dichlorophenyl)ethyl]ethanamine.
| Compound Name | (1R)-1-cycloheptyl-N-[1-(2,5-dichlorophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81392727 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (1R)-1-cycloheptyl-N-[1-(2,5-dichlorophenyl)ethyl]ethanamine |
| SMILES | CC(N[C@H](C)C1CCCCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H25Cl2N/c1-12(14-7-5-3-4-6-8-14)20-13(2)16-11-15(18)9-10-17(16)19/h9-14,20H,3-8H2,1-2H3/t12-,13?/m1/s1 |
| InChIKey | FEKDODZYNHTULY-PZORYLMUSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |