C17H27N — CID 63479047
1-cyclohexyl-N-[(2,4-dimethylphenyl)methyl]ethanamine (PubChem CID 63479047) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(2,4-dimethylphenyl)methyl]ethanamine.
| Compound Name | 1-cyclohexyl-N-[(2,4-dimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63479047 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1-cyclohexyl-N-[(2,4-dimethylphenyl)methyl]ethanamine |
| SMILES | Cc1ccc(CNC(C)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H27N/c1-13-9-10-17(14(2)11-13)12-18-15(3)16-7-5-4-6-8-16/h9-11,15-16,18H,4-8,12H2,1-3H3 |
| InChIKey | JTZMYTDTNUZZPM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |