C15H20N2 — CID 43755634
N-(3-methylphenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43755634) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(3-methylphenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(3-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43755634 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-(3-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C15H20N2/c1-3-9-17-10-7-14(8-11-17)16-15-6-4-5-13(2)12-15/h1,4-6,12,14,16H,7-11H2,2H3 |
| InChIKey | ZTDJZGFDLRYPIA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|