C14H16Cl2N2 — CID 43760832
N-(3,4-dichlorophenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43760832) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(3,4-dichlorophenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43760832 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2/c1-2-7-18-8-5-11(6-9-18)17-12-3-4-13(15)14(16)10-12/h1,3-4,10-11,17H,5-9H2 |
| InChIKey | IKRZEVGHGUBESQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|