C17H24N2O — CID 43789706
N-(3-methoxy-2,4-dimethylphenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43789706) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(3-methoxy-2,4-dimethylphenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(3-methoxy-2,4-dimethylphenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43789706 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(3-methoxy-2,4-dimethylphenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2ccc(C)c(OC)c2C)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-5-10-19-11-8-15(9-12-19)18-16-7-6-13(2)17(20-4)14(16)3/h1,6-7,15,18H,8-12H2,2-4H3 |
| InChIKey | RVSPOWPQDCRJHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|