C17H24N2O2 — CID 43785160
N-(4,5-dimethoxy-2-methylphenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43785160) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43785160 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2cc(OC)c(OC)cc2C)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-5-8-19-9-6-14(7-10-19)18-15-12-17(21-4)16(20-3)11-13(15)2/h1,11-12,14,18H,6-10H2,2-4H3 |
| InChIKey | ZOFBHAYLPABGIL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|