C15H20N2S — CID 43781005
N-(2-methylsulfanylphenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43781005) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(2-methylsulfanylphenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43781005 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2ccccc2SC)CC1 |
| InChI | InChI=1S/C15H20N2S/c1-3-10-17-11-8-13(9-12-17)16-14-6-4-5-7-15(14)18-2/h1,4-7,13,16H,8-12H2,2H3 |
| InChIKey | RDJKUOSTNOHCBK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|