C16H21Cl3N2 — CID 43759083
1-(3-methylbut-2-enyl)-N-(2,4,5-trichlorophenyl)piperidin-4-amine (PubChem CID 43759083) has the molecular formula C16H21Cl3N2 and a molecular weight of 347.72 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-(2,4,5-trichlorophenyl)piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-(2,4,5-trichlorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 43759083 |
| Molecular Formula | C16H21Cl3N2 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-(2,4,5-trichlorophenyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(Nc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl3N2/c1-11(2)3-6-21-7-4-12(5-8-21)20-16-10-14(18)13(17)9-15(16)19/h3,9-10,12,20H,4-8H2,1-2H3 |
| InChIKey | JXUXSYVTCPPNGY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|