C17H25BrN2 — CID 107582294
N-(3-bromo-5-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 107582294) has the molecular formula C17H25BrN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N-(3-bromo-5-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107582294 |
| Molecular Formula | C17H25BrN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(Nc2cc(C)cc(Br)c2)CC1 |
| InChI | InChI=1S/C17H25BrN2/c1-13(2)4-7-20-8-5-16(6-9-20)19-17-11-14(3)10-15(18)12-17/h4,10-12,16,19H,5-9H2,1-3H3 |
| InChIKey | VIDMHTBXKUEPDI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|