C13H17BrINO — CID 114259179
N-(2-bromo-4-iodophenyl)-2,2-dimethyloxan-4-amine (PubChem CID 114259179) has the molecular formula C13H17BrINO and a molecular weight of 410.09 g/mol. Its IUPAC name is N-(2-bromo-4-iodophenyl)-2,2-dimethyloxan-4-amine.
| Compound Name | N-(2-bromo-4-iodophenyl)-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 114259179 |
| Molecular Formula | C13H17BrINO |
| Molecular Weight | 410.09 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | N-(2-bromo-4-iodophenyl)-2,2-dimethyloxan-4-amine |
| SMILES | CC1(C)CC(Nc2ccc(I)cc2Br)CCO1 |
| InChI | InChI=1S/C13H17BrINO/c1-13(2)8-10(5-6-17-13)16-12-4-3-9(15)7-11(12)14/h3-4,7,10,16H,5-6,8H2,1-2H3 |
| InChIKey | WEQWHSJZDPQKNJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.09 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|