C15H22INO — CID 83032780
N-[1-(4-iodophenyl)ethyl]-2,2-dimethyloxan-4-amine (PubChem CID 83032780) has the molecular formula C15H22INO and a molecular weight of 359.25 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)ethyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[1-(4-iodophenyl)ethyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 83032780 |
| Molecular Formula | C15H22INO |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[1-(4-iodophenyl)ethyl]-2,2-dimethyloxan-4-amine |
| SMILES | CC(NC1CCOC(C)(C)C1)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H22INO/c1-11(12-4-6-13(16)7-5-12)17-14-8-9-18-15(2,3)10-14/h4-7,11,14,17H,8-10H2,1-3H3 |
| InChIKey | UOTSWCNVZCPRHQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|