C16H25NO — CID 81373174
2,2-dimethyl-N-[(1R)-1-(2-methylphenyl)ethyl]oxan-4-amine (PubChem CID 81373174) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1R)-1-(2-methylphenyl)ethyl]oxan-4-amine.
| Compound Name | 2,2-dimethyl-N-[(1R)-1-(2-methylphenyl)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 81373174 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2,2-dimethyl-N-[(1R)-1-(2-methylphenyl)ethyl]oxan-4-amine |
| SMILES | Cc1ccccc1[C@@H](C)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C16H25NO/c1-12-7-5-6-8-15(12)13(2)17-14-9-10-18-16(3,4)11-14/h5-8,13-14,17H,9-11H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | QHRMZRUYRXYJBB-KWCCSABGSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |