C15H22FNO — CID 81380158
N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethyloxan-4-amine (PubChem CID 81380158) has the molecular formula C15H22FNO and a molecular weight of 251.35 g/mol. Its IUPAC name is N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 81380158 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethyloxan-4-amine |
| SMILES | C[C@@H](NC1CCOC(C)(C)C1)c1ccccc1F |
| InChI | InChI=1S/C15H22FNO/c1-11(13-6-4-5-7-14(13)16)17-12-8-9-18-15(2,3)10-12/h4-7,11-12,17H,8-10H2,1-3H3/t11-,12?/m1/s1 |
| InChIKey | XZBSHDPNENHJKT-JHJMLUEUSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |