C15H21F2NO — CID 83033287
N-[1-(3,5-difluorophenyl)ethyl]-2,2-dimethyloxan-4-amine (PubChem CID 83033287) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)ethyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[1-(3,5-difluorophenyl)ethyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 83033287 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)ethyl]-2,2-dimethyloxan-4-amine |
| SMILES | CC(NC1CCOC(C)(C)C1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H21F2NO/c1-10(11-6-12(16)8-13(17)7-11)18-14-4-5-19-15(2,3)9-14/h6-8,10,14,18H,4-5,9H2,1-3H3 |
| InChIKey | PALSPLXMPYTQRM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |