C13H20BrNOS — CID 83032784
N-[1-(5-bromothiophen-2-yl)ethyl]-2,2-dimethyloxan-4-amine (PubChem CID 83032784) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 83032784 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,2-dimethyloxan-4-amine |
| SMILES | CC(NC1CCOC(C)(C)C1)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H20BrNOS/c1-9(11-4-5-12(14)17-11)15-10-6-7-16-13(2,3)8-10/h4-5,9-10,15H,6-8H2,1-3H3 |
| InChIKey | YMPDFDBNBIDENL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |