About (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine
(4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine (PubChem CID 40917163) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine |
| PubChem CID | 40917163 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine |
| SMILES | COc1ccc([C@H](N[C@@H]2CCOC(C)(C)C2)C(C)C)cc1 |
| InChI | InChI=1S/C18H29NO2/c1-13(2)17(14-6-8-16(20-5)9-7-14)19-15-10-11-21-18(3,4)12-15/h6-9,13,15,17,19H,10-12H2,1-5H3/t15-,17-/m1/s1 |
| InChIKey | LLBTWBHSCBMVQB-NVXWUHKLSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine?
The IUPAC name of (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine (CID 40917163) is (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine.
What is the SMILES notation for (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine?
The canonical SMILES for (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine is COc1ccc([C@H](N[C@@H]2CCOC(C)(C)C2)C(C)C)cc1.
What is the InChIKey of (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine?
The InChIKey is LLBTWBHSCBMVQB-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H29NO2/c1-13(2)17(14-6-8-16(20-5)9-7-14)19-15-10-11-21-18(3,4)12-15/h6-9,13,15,17,19H,10-12H2,1-5H3/t15-,17-/m1/s1.
What are the key properties of (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine?
(4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine has a molecular weight of 291.44 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-2,2-dimethyloxan-4-amine is sourced from PubChem (CID 40917163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).