C13H27NO — CID 115896330
N-(3,3-dimethylbutan-2-yl)-2,2-dimethyloxan-4-amine (PubChem CID 115896330) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,2-dimethyloxan-4-amine.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115896330 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,2-dimethyloxan-4-amine |
| SMILES | CC(NC1CCOC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-10(12(2,3)4)14-11-7-8-15-13(5,6)9-11/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | KFVFRHADLUUJSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |