About 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide
3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide (PubChem CID 83027581) has the molecular formula C13H21N3O3S
and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide |
| PubChem CID | 83027581 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide |
| SMILES | CC1(C)CC(Nc2ccc(S(N)(=O)=O)cc2N)CCO1 |
| InChI | InChI=1S/C13H21N3O3S/c1-13(2)8-9(5-6-19-13)16-12-4-3-10(7-11(12)14)20(15,17)18/h3-4,7,9,16H,5-6,8,14H2,1-2H3,(H2,15,17,18) |
| InChIKey | CVFUDWVGTJQUHR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide?
The IUPAC name of 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide (CID 83027581) is 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide.
What is the SMILES notation for 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide?
The canonical SMILES for 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide is CC1(C)CC(Nc2ccc(S(N)(=O)=O)cc2N)CCO1.
What is the InChIKey of 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide?
The InChIKey is CVFUDWVGTJQUHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3S/c1-13(2)8-9(5-6-19-13)16-12-4-3-10(7-11(12)14)20(15,17)18/h3-4,7,9,16H,5-6,8,14H2,1-2H3,(H2,15,17,18).
What are the key properties of 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide?
3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide has a molecular weight of 299.40 g/mol, XLogP of 1.29, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]benzenesulfonamide is sourced from PubChem (CID 83027581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).