C14H23N3O3S — CID 83035007
2-amino-4-[(2,2-dimethyloxan-4-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 83035007) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-amino-4-[(2,2-dimethyloxan-4-yl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4-[(2,2-dimethyloxan-4-yl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 83035007 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-amino-4-[(2,2-dimethyloxan-4-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC2CCOC(C)(C)C2)cc1N |
| InChI | InChI=1S/C14H23N3O3S/c1-14(2)9-11(6-7-20-14)17-10-4-5-13(12(15)8-10)21(18,19)16-3/h4-5,8,11,16-17H,6-7,9,15H2,1-3H3 |
| InChIKey | HXWJAADAJYMRCE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|