C12H19N3O2S — CID 80646229
2-amino-4-[(2,2-dimethylcyclopropyl)amino]-N-methylbenzenesulfonamide (PubChem CID 80646229) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-4-[(2,2-dimethylcyclopropyl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4-[(2,2-dimethylcyclopropyl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80646229 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-4-[(2,2-dimethylcyclopropyl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC2CC2(C)C)cc1N |
| InChI | InChI=1S/C12H19N3O2S/c1-12(2)7-11(12)15-8-4-5-10(9(13)6-8)18(16,17)14-3/h4-6,11,14-15H,7,13H2,1-3H3 |
| InChIKey | CWNKXEPFENIKNJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|