C11H16N4O3S — CID 106183085
2-amino-N-methyl-4-[(5-oxopyrrolidin-3-yl)amino]benzenesulfonamide (PubChem CID 106183085) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-amino-N-methyl-4-[(5-oxopyrrolidin-3-yl)amino]benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-[(5-oxopyrrolidin-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106183085 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-amino-N-methyl-4-[(5-oxopyrrolidin-3-yl)amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC2CNC(=O)C2)cc1N |
| InChI | InChI=1S/C11H16N4O3S/c1-13-19(17,18)10-3-2-7(4-9(10)12)15-8-5-11(16)14-6-8/h2-4,8,13,15H,5-6,12H2,1H3,(H,14,16) |
| InChIKey | GSJAVMVFJXEIMX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|