C9H16N4O4S2 — CID 80645656
2-amino-N-methyl-4-(2-sulfamoylethylamino)benzenesulfonamide (PubChem CID 80645656) has the molecular formula C9H16N4O4S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-amino-N-methyl-4-(2-sulfamoylethylamino)benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-(2-sulfamoylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 80645656 |
| Molecular Formula | C9H16N4O4S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-amino-N-methyl-4-(2-sulfamoylethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCS(N)(=O)=O)cc1N |
| InChI | InChI=1S/C9H16N4O4S2/c1-12-19(16,17)9-3-2-7(6-8(9)10)13-4-5-18(11,14)15/h2-3,6,12-13H,4-5,10H2,1H3,(H2,11,14,15) |
| InChIKey | GBCGDYRMHUOSKQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|