C10H17N3O3S — CID 80645934
2-amino-4-(3-hydroxypropylamino)-N-methylbenzenesulfonamide (PubChem CID 80645934) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxypropylamino)-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4-(3-hydroxypropylamino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80645934 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-amino-4-(3-hydroxypropylamino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCCO)cc1N |
| InChI | InChI=1S/C10H17N3O3S/c1-12-17(15,16)10-4-3-8(7-9(10)11)13-5-2-6-14/h3-4,7,12-14H,2,5-6,11H2,1H3 |
| InChIKey | MJJOYNGXKGAIGD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|