C10H16N4O4S — CID 83202387
2-[3-amino-4-(methylsulfamoyl)anilino]ethyl carbamate (PubChem CID 83202387) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[3-amino-4-(methylsulfamoyl)anilino]ethyl carbamate.
| Compound Name | 2-[3-amino-4-(methylsulfamoyl)anilino]ethyl carbamate |
|---|---|
| PubChem CID | 83202387 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[3-amino-4-(methylsulfamoyl)anilino]ethyl carbamate |
| SMILES | CNS(=O)(=O)c1ccc(NCCOC(N)=O)cc1N |
| InChI | InChI=1S/C10H16N4O4S/c1-13-19(16,17)9-3-2-7(6-8(9)11)14-4-5-18-10(12)15/h2-3,6,13-14H,4-5,11H2,1H3,(H2,12,15) |
| InChIKey | RZIUDDMQZVODMP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|