C10H16N4O4S — CID 106234450
2-[2-(3-amino-4-sulfamoylanilino)ethoxy]acetamide (PubChem CID 106234450) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[2-(3-amino-4-sulfamoylanilino)ethoxy]acetamide.
| Compound Name | 2-[2-(3-amino-4-sulfamoylanilino)ethoxy]acetamide |
|---|---|
| PubChem CID | 106234450 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-(3-amino-4-sulfamoylanilino)ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1ccc(S(N)(=O)=O)c(N)c1 |
| InChI | InChI=1S/C10H16N4O4S/c11-8-5-7(1-2-9(8)19(13,16)17)14-3-4-18-6-10(12)15/h1-2,5,14H,3-4,6,11H2,(H2,12,15)(H2,13,16,17) |
| InChIKey | KGBMHOBPPZDWHL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 150.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|