C11H14ClN3O2S — CID 106237332
2-[2-(4-carbamothioyl-3-chloroanilino)ethoxy]acetamide (PubChem CID 106237332) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-[2-(4-carbamothioyl-3-chloroanilino)ethoxy]acetamide.
| Compound Name | 2-[2-(4-carbamothioyl-3-chloroanilino)ethoxy]acetamide |
|---|---|
| PubChem CID | 106237332 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[2-(4-carbamothioyl-3-chloroanilino)ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O2S/c12-9-5-7(1-2-8(9)11(14)18)15-3-4-17-6-10(13)16/h1-2,5,15H,3-4,6H2,(H2,13,16)(H2,14,18) |
| InChIKey | LZHDHWVUTXYDSH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|