C12H14ClF3N2S — CID 115519923
2-chloro-4-(5,5,5-trifluoropentylamino)benzenecarbothioamide (PubChem CID 115519923) has the molecular formula C12H14ClF3N2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 2-chloro-4-(5,5,5-trifluoropentylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(5,5,5-trifluoropentylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 115519923 |
| Molecular Formula | C12H14ClF3N2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-chloro-4-(5,5,5-trifluoropentylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCCCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H14ClF3N2S/c13-10-7-8(3-4-9(10)11(17)19)18-6-2-1-5-12(14,15)16/h3-4,7,18H,1-2,5-6H2,(H2,17,19) |
| InChIKey | VDPWRGGZXJXDIS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|