C11H15ClN2S — CID 62948609
2-chloro-4-(2-methylpropylamino)benzenecarbothioamide (PubChem CID 62948609) has the molecular formula C11H15ClN2S and a molecular weight of 242.78 g/mol. Its IUPAC name is 2-chloro-4-(2-methylpropylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(2-methylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 62948609 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.78 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-chloro-4-(2-methylpropylamino)benzenecarbothioamide |
| SMILES | CC(C)CNc1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2S/c1-7(2)6-14-8-3-4-9(11(13)15)10(12)5-8/h3-5,7,14H,6H2,1-2H3,(H2,13,15) |
| InChIKey | UWUYBVAPDXOGNZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|