C12H15ClN2S — CID 62947448
2-chloro-4-(cyclobutylmethylamino)benzenecarbothioamide (PubChem CID 62947448) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 2-chloro-4-(cyclobutylmethylamino)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(cyclobutylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 62947448 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-4-(cyclobutylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCC2CCC2)cc1Cl |
| InChI | InChI=1S/C12H15ClN2S/c13-11-6-9(4-5-10(11)12(14)16)15-7-8-2-1-3-8/h4-6,8,15H,1-3,7H2,(H2,14,16) |
| InChIKey | GYAQICJCQDUVLK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|