C10H13ClN4OS — CID 83121142
2-(4-carbamothioyl-3-chloroanilino)ethylurea (PubChem CID 83121142) has the molecular formula C10H13ClN4OS and a molecular weight of 272.76 g/mol. Its IUPAC name is 2-(4-carbamothioyl-3-chloroanilino)ethylurea.
| Compound Name | 2-(4-carbamothioyl-3-chloroanilino)ethylurea |
|---|---|
| PubChem CID | 83121142 |
| Molecular Formula | C10H13ClN4OS |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(4-carbamothioyl-3-chloroanilino)ethylurea |
| SMILES | NC(=O)NCCNc1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClN4OS/c11-8-5-6(1-2-7(8)9(12)17)14-3-4-15-10(13)16/h1-2,5,14H,3-4H2,(H2,12,17)(H3,13,15,16) |
| InChIKey | VEJHJMLRHKVCSV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|