C11H15N5O3S — CID 106393801
2-amino-N-methyl-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzenesulfonamide (PubChem CID 106393801) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-amino-N-methyl-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106393801 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-amino-N-methyl-4-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCc2ncno2)cc1N |
| InChI | InChI=1S/C11H15N5O3S/c1-13-20(17,18)10-3-2-8(6-9(10)12)14-5-4-11-15-7-16-19-11/h2-3,6-7,13-14H,4-5,12H2,1H3 |
| InChIKey | VRYIDWJDCVUNJM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|