C11H11F3N4O — CID 106393641
4-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 106393641) has the molecular formula C11H11F3N4O and a molecular weight of 272.23 g/mol. Its IUPAC name is 4-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106393641 |
| Molecular Formula | C11H11F3N4O |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCc2ncno2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N4O/c12-11(13,14)8-5-7(1-2-9(8)15)16-4-3-10-17-6-18-19-10/h1-2,5-6,16H,3-4,15H2 |
| InChIKey | PUGMRWWGYVNUMM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|