C10H10F6N2S — CID 106426395
2-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine (PubChem CID 106426395) has the molecular formula C10H10F6N2S and a molecular weight of 304.26 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine.
| Compound Name | 2-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106426395 |
| Molecular Formula | C10H10F6N2S |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(trifluoromethyl)-4-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCSC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2S/c11-9(12,13)7-5-6(1-2-8(7)17)18-3-4-19-10(14,15)16/h1-2,5,18H,3-4,17H2 |
| InChIKey | SMYYAFDUMXOYFE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|