C14H12F4N2 — CID 43115470
4-N-[(4-fluorophenyl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 43115470) has the molecular formula C14H12F4N2 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-N-[(4-fluorophenyl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[(4-fluorophenyl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43115470 |
| Molecular Formula | C14H12F4N2 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-N-[(4-fluorophenyl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12F4N2/c15-10-3-1-9(2-4-10)8-20-11-5-6-13(19)12(7-11)14(16,17)18/h1-7,20H,8,19H2 |
| InChIKey | OQVWBCKVWBCZFP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|