C12H12F3N3S — CID 61281277
4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 61281277) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61281277 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Cc1nc(CNc2ccc(N)c(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C12H12F3N3S/c1-7-18-9(6-19-7)5-17-8-2-3-11(16)10(4-8)12(13,14)15/h2-4,6,17H,5,16H2,1H3 |
| InChIKey | PGNOCANQMKMTCJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|