C11H13N3S — CID 61281093
2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 61281093) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,2-diamine.
| Compound Name | 2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 61281093 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1nc(CNc2ccccc2N)cs1 |
| InChI | InChI=1S/C11H13N3S/c1-8-14-9(7-15-8)6-13-11-5-3-2-4-10(11)12/h2-5,7,13H,6,12H2,1H3 |
| InChIKey | VUTXBGXACBIQTM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|