C11H11IN2S — CID 28878584
2-iodo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]aniline (PubChem CID 28878584) has the molecular formula C11H11IN2S and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-iodo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]aniline.
| Compound Name | 2-iodo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 28878584 |
| Molecular Formula | C11H11IN2S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 2-iodo-N-[(2-methyl-1,3-thiazol-4-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2ccccc2I)cs1 |
| InChI | InChI=1S/C11H11IN2S/c1-8-14-9(7-15-8)6-13-11-5-3-2-4-10(11)12/h2-5,7,13H,6H2,1H3 |
| InChIKey | OQSSUDOZSKDHQZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|