C14H11F4N3O — CID 16777157
1-[4-amino-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)urea (PubChem CID 16777157) has the molecular formula C14H11F4N3O and a molecular weight of 313.25 g/mol. Its IUPAC name is 1-[4-amino-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-amino-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 16777157 |
| Molecular Formula | C14H11F4N3O |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-[4-amino-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)urea |
| SMILES | Nc1ccc(NC(=O)Nc2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H11F4N3O/c15-8-1-3-9(4-2-8)20-13(22)21-10-5-6-12(19)11(7-10)14(16,17)18/h1-7H,19H2,(H2,20,21,22) |
| InChIKey | VQJZFNQFQZSMNU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|