C22H19F3N4O3 — CID 58263513
1-[4-amino-3-(trifluoromethyl)phenyl]-3-[4-[(2-propanoyl-4-pyridinyl)oxy]phenyl]urea (PubChem CID 58263513) has the molecular formula C22H19F3N4O3 and a molecular weight of 444.41 g/mol. Its IUPAC name is 1-[4-amino-3-(trifluoromethyl)phenyl]-3-[4-[(2-propanoyl-4-pyridinyl)oxy]phenyl]urea.
| Compound Name | 1-[4-amino-3-(trifluoromethyl)phenyl]-3-[4-[(2-propanoyl-4-pyridinyl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 58263513 |
| Molecular Formula | C22H19F3N4O3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-[4-amino-3-(trifluoromethyl)phenyl]-3-[4-[(2-propanoyl-4-pyridinyl)oxy]phenyl]urea |
| SMILES | CCC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(N)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C22H19F3N4O3/c1-2-20(30)19-12-16(9-10-27-19)32-15-6-3-13(4-7-15)28-21(31)29-14-5-8-18(26)17(11-14)22(23,24)25/h3-12H,2,26H2,1H3,(H2,28,29,31) |
| InChIKey | VYLURKWNLKFIQJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|