C23H21ClF3N3O2 — CID 167119734
1-[4-[(2-butan-2-yl-4-pyridinyl)oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 167119734) has the molecular formula C23H21ClF3N3O2 and a molecular weight of 463.89 g/mol. Its IUPAC name is 1-[4-[(2-butan-2-yl-4-pyridinyl)oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(2-butan-2-yl-4-pyridinyl)oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 167119734 |
| Molecular Formula | C23H21ClF3N3O2 |
| Molecular Weight | 463.89 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[4-[(2-butan-2-yl-4-pyridinyl)oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CCC(C)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C23H21ClF3N3O2/c1-3-14(2)21-13-18(10-11-28-21)32-17-7-4-15(5-8-17)29-22(31)30-16-6-9-20(24)19(12-16)23(25,26)27/h4-14H,3H2,1-2H3,(H2,29,30,31) |
| InChIKey | WDQUQZWTBIWWMM-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.89 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |