C10H12F2N2O — CID 143186185
N-[4-amino-3-(1,1-difluoroethyl)phenyl]acetamide (PubChem CID 143186185) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is N-[4-amino-3-(1,1-difluoroethyl)phenyl]acetamide.
| Compound Name | N-[4-amino-3-(1,1-difluoroethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143186185 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[4-amino-3-(1,1-difluoroethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N)c(C(C)(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2O/c1-6(15)14-7-3-4-9(13)8(5-7)10(2,11)12/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | NVYUKMLJWOTXOD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|