C12H16F3N3O — CID 79154112
3-[4-amino-3-(trifluoromethyl)phenyl]-1,1-diethylurea (PubChem CID 79154112) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-[4-amino-3-(trifluoromethyl)phenyl]-1,1-diethylurea.
| Compound Name | 3-[4-amino-3-(trifluoromethyl)phenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 79154112 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[4-amino-3-(trifluoromethyl)phenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N3O/c1-3-18(4-2)11(19)17-8-5-6-10(16)9(7-8)12(13,14)15/h5-7H,3-4,16H2,1-2H3,(H,17,19) |
| InChIKey | NPUIXDRHEJGHHC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|