C14H13F3N2O2 — CID 79095580
N-[4-amino-3-(trifluoromethyl)phenyl]-5-ethylfuran-2-carboxamide (PubChem CID 79095580) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-5-ethylfuran-2-carboxamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-5-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 79095580 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-5-ethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(N)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-2-9-4-6-12(21-9)13(20)19-8-3-5-11(18)10(7-8)14(15,16)17/h3-7H,2,18H2,1H3,(H,19,20) |
| InChIKey | GJHIESACOLUJRL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|