C20H23F3N2O4 — CID 16770916
N-[4-amino-3-(trifluoromethyl)phenyl]-3,4,5-triethoxybenzamide (PubChem CID 16770916) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 16770916 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(N)c(C(F)(F)F)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H23F3N2O4/c1-4-27-16-9-12(10-17(28-5-2)18(16)29-6-3)19(26)25-13-7-8-15(24)14(11-13)20(21,22)23/h7-11H,4-6,24H2,1-3H3,(H,25,26) |
| InChIKey | MGUMVKNWTQAARX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|