C17H12Cl2F3NO3 — CID 88964633
3,5-dichloro-4-ethoxy-N-[4-formyl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 88964633) has the molecular formula C17H12Cl2F3NO3 and a molecular weight of 406.19 g/mol. Its IUPAC name is 3,5-dichloro-4-ethoxy-N-[4-formyl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-4-ethoxy-N-[4-formyl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 88964633 |
| Molecular Formula | C17H12Cl2F3NO3 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 3,5-dichloro-4-ethoxy-N-[4-formyl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc(C=O)c(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C17H12Cl2F3NO3/c1-2-26-15-13(18)5-10(6-14(15)19)16(25)23-11-4-3-9(8-24)12(7-11)17(20,21)22/h3-8H,2H2,1H3,(H,23,25) |
| InChIKey | XHDHTILMPJCFEN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|