C20H22ClNO5 — CID 88538932
3-chloro-N-(4-formyl-3-hydroxyphenyl)-4,5-di(propan-2-yloxy)benzamide (PubChem CID 88538932) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 3-chloro-N-(4-formyl-3-hydroxyphenyl)-4,5-di(propan-2-yloxy)benzamide.
| Compound Name | 3-chloro-N-(4-formyl-3-hydroxyphenyl)-4,5-di(propan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 88538932 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-chloro-N-(4-formyl-3-hydroxyphenyl)-4,5-di(propan-2-yloxy)benzamide |
| SMILES | CC(C)Oc1cc(C(=O)Nc2ccc(C=O)c(O)c2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C20H22ClNO5/c1-11(2)26-18-8-14(7-16(21)19(18)27-12(3)4)20(25)22-15-6-5-13(10-23)17(24)9-15/h5-12,24H,1-4H3,(H,22,25) |
| InChIKey | CHICAQFORUBIMK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|