C20H23ClN2O6 — CID 24645296
3-chloro-N'-(3,4-dimethoxybenzoyl)-5-methoxy-4-propan-2-yloxybenzohydrazide (PubChem CID 24645296) has the molecular formula C20H23ClN2O6 and a molecular weight of 422.87 g/mol. Its IUPAC name is 3-chloro-N'-(3,4-dimethoxybenzoyl)-5-methoxy-4-propan-2-yloxybenzohydrazide.
| Compound Name | 3-chloro-N'-(3,4-dimethoxybenzoyl)-5-methoxy-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 24645296 |
| Molecular Formula | C20H23ClN2O6 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-chloro-N'-(3,4-dimethoxybenzoyl)-5-methoxy-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cc(Cl)c(OC(C)C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O6/c1-11(2)29-18-14(21)8-13(10-17(18)28-5)20(25)23-22-19(24)12-6-7-15(26-3)16(9-12)27-4/h6-11H,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | LSKYEEDAHIFQCQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|