C19H21ClN2O6 — CID 9439809
3-chloro-N'-(4-ethoxy-3-methoxybenzoyl)-4,5-dimethoxybenzohydrazide (PubChem CID 9439809) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is 3-chloro-N'-(4-ethoxy-3-methoxybenzoyl)-4,5-dimethoxybenzohydrazide.
| Compound Name | 3-chloro-N'-(4-ethoxy-3-methoxybenzoyl)-4,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 9439809 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-chloro-N'-(4-ethoxy-3-methoxybenzoyl)-4,5-dimethoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2cc(Cl)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H21ClN2O6/c1-5-28-14-7-6-11(9-15(14)25-2)18(23)21-22-19(24)12-8-13(20)17(27-4)16(10-12)26-3/h6-10H,5H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | QBDMMLABYOAHOS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|