C18H18ClNO5 — CID 67977754
4-[(3-chloro-4-methyl-5-propan-2-yloxybenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 67977754) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-[(3-chloro-4-methyl-5-propan-2-yloxybenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3-chloro-4-methyl-5-propan-2-yloxybenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 67977754 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-[(3-chloro-4-methyl-5-propan-2-yloxybenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | Cc1c(Cl)cc(C(=O)Nc2ccc(C(=O)O)c(O)c2)cc1OC(C)C |
| InChI | InChI=1S/C18H18ClNO5/c1-9(2)25-16-7-11(6-14(19)10(16)3)17(22)20-12-4-5-13(18(23)24)15(21)8-12/h4-9,21H,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | OJIYSYKPHNJCDH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |